C14H14BrN3O3S — CID 8535910
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535910) has the molecular formula C14H14BrN3O3S and a molecular weight of 384.26 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535910 |
| Molecular Formula | C14H14BrN3O3S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C14H14BrN3O3S/c1-3-10-13(22-18-17-10)14(20)21-7-12(19)16-11-5-4-9(15)6-8(11)2/h4-6H,3,7H2,1-2H3,(H,16,19) |
| InChIKey | QFQRKKZDEAXLSA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |