C13H22N2O — CID 853663
3-cyclohexyl-1,1-bis(prop-2-enyl)urea (PubChem CID 853663) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-cyclohexyl-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 853663 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-cyclohexyl-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-3-10-15(11-4-2)13(16)14-12-8-6-5-7-9-12/h3-4,12H,1-2,5-11H2,(H,14,16) |
| InChIKey | XPIAAFPDZJIJKC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|