C20H24N2O5 — CID 8537580
4-(4-methoxy-2-nitrophenoxy)-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 8537580) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-(4-methoxy-2-nitrophenoxy)-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-(4-methoxy-2-nitrophenoxy)-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 8537580 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-(4-methoxy-2-nitrophenoxy)-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2c(C)cc(C)cc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N2O5/c1-13-10-14(2)20(15(3)11-13)21-19(23)6-5-9-27-18-8-7-16(26-4)12-17(18)22(24)25/h7-8,10-12H,5-6,9H2,1-4H3,(H,21,23) |
| InChIKey | XNCJHCPAQFHPEN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|