C19H21BrN2O5 — CID 19202481
4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-2-nitrophenyl)butanamide (PubChem CID 19202481) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-2-nitrophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-2-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 19202481 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-2-nitrophenyl)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C19H21BrN2O5/c1-3-13-6-9-18(15(20)11-13)27-10-4-5-19(23)21-16-8-7-14(26-2)12-17(16)22(24)25/h6-9,11-12H,3-5,10H2,1-2H3,(H,21,23) |
| InChIKey | GCZHXGAIURANAS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|