C11H14O2 — CID 85377420
3-ethynyl-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 85377420) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-ethynyl-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-ethynyl-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 85377420 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-ethynyl-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C#CC1=C(C)C(=O)C(O)CC1(C)C |
| InChI | InChI=1S/C11H14O2/c1-5-8-7(2)10(13)9(12)6-11(8,3)4/h1,9,12H,6H2,2-4H3 |
| InChIKey | XZPAHFIDGRLQGA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|