C19H18N2O4 — CID 8538255
ethyl 3-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]oxybenzoate (PubChem CID 8538255) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 3-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]oxybenzoate.
| Compound Name | ethyl 3-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 8538255 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 3-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]oxybenzoate |
| SMILES | CCOC(=O)c1cccc(O[C@@H](C)C(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-3-24-19(23)15-5-4-6-17(11-15)25-13(2)18(22)21-16-9-7-14(12-20)8-10-16/h4-11,13H,3H2,1-2H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | TUZLDVVSBKVRCE-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |