C8H13N3O2 — CID 853898
6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione (PubChem CID 853898) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 853898 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione |
| SMILES | CC(C)Cn1c(N)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)4-11-6(9)3-7(12)10-8(11)13/h3,5H,4,9H2,1-2H3,(H,10,12,13) |
| InChIKey | QTAYOSNLQPIPFG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |