About 5,5-diethoxypent-3-en-2-ol
5,5-diethoxypent-3-en-2-ol (PubChem CID 85393239) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 5,5-diethoxypent-3-en-2-ol.
Molecular Properties
| Compound Name | 5,5-diethoxypent-3-en-2-ol |
| PubChem CID | 85393239 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 5,5-diethoxypent-3-en-2-ol |
| SMILES | CCOC(C=CC(C)O)OCC |
| InChI | InChI=1S/C9H18O3/c1-4-11-9(12-5-2)7-6-8(3)10/h6-10H,4-5H2,1-3H3 |
| InChIKey | YYFUYVCWRWIQRW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diethoxypent-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethoxypent-3-en-2-ol?
The IUPAC name of 5,5-diethoxypent-3-en-2-ol (CID 85393239) is 5,5-diethoxypent-3-en-2-ol.
What is the SMILES notation for 5,5-diethoxypent-3-en-2-ol?
The canonical SMILES for 5,5-diethoxypent-3-en-2-ol is CCOC(C=CC(C)O)OCC.
What is the InChIKey of 5,5-diethoxypent-3-en-2-ol?
The InChIKey is YYFUYVCWRWIQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-4-11-9(12-5-2)7-6-8(3)10/h6-10H,4-5H2,1-3H3.
What are the key properties of 5,5-diethoxypent-3-en-2-ol?
5,5-diethoxypent-3-en-2-ol has a molecular weight of 174.24 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethoxypent-3-en-2-ol is sourced from PubChem (CID 85393239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).