C21H19N3O2S2 — CID 8539618
N-methyl-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 8539618) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-methyl-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | N-methyl-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8539618 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-methyl-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CN(Cc1ccsc1)C(=O)CSc1nc2cc3ccccc3cc2c(=O)n1C |
| InChI | InChI=1S/C21H19N3O2S2/c1-23(11-14-7-8-27-12-14)19(25)13-28-21-22-18-10-16-6-4-3-5-15(16)9-17(18)20(26)24(21)2/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | SEDKCSZBHFLPRJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|