C25H25N3O2S — CID 30082558
2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methyl-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 30082558) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methyl-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30082558 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | CCn1c(SCC(=O)N(C)Cc2ccccc2C)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C25H25N3O2S/c1-4-28-24(30)21-13-18-10-7-8-11-19(18)14-22(21)26-25(28)31-16-23(29)27(3)15-20-12-6-5-9-17(20)2/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | IQVLODWQBALKEB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|