C22H18N2O2 — CID 85398671
5-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]penta-2,4-dienenitrile (PubChem CID 85398671) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]penta-2,4-dienenitrile.
| Compound Name | 5-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 85398671 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]penta-2,4-dienenitrile |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccccc1C=CC=CC#N |
| InChI | InChI=1S/C22H18N2O2/c1-17-20(24-22(26-17)19-12-4-2-5-13-19)16-25-21-14-8-7-11-18(21)10-6-3-9-15-23/h2-14H,16H2,1H3 |
| InChIKey | LRRWYVBAFFJPPM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|