C26H29NO6 — CID 85399579
N-benzoyl-N-[3-[2-(5-hydroxyhex-2-enyl)-1,3-dioxolan-2-yl]propanoyl]benzamide (PubChem CID 85399579) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is N-benzoyl-N-[3-[2-(5-hydroxyhex-2-enyl)-1,3-dioxolan-2-yl]propanoyl]benzamide.
| Compound Name | N-benzoyl-N-[3-[2-(5-hydroxyhex-2-enyl)-1,3-dioxolan-2-yl]propanoyl]benzamide |
|---|---|
| PubChem CID | 85399579 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-benzoyl-N-[3-[2-(5-hydroxyhex-2-enyl)-1,3-dioxolan-2-yl]propanoyl]benzamide |
| SMILES | CC(O)CC=CCC1(CCC(=O)N(C(=O)c2ccccc2)C(=O)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C26H29NO6/c1-20(28)10-8-9-16-26(32-18-19-33-26)17-15-23(29)27(24(30)21-11-4-2-5-12-21)25(31)22-13-6-3-7-14-22/h2-9,11-14,20,28H,10,15-19H2,1H3 |
| InChIKey | FETKGBPCMRCJGW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|