C16H19NO4 — CID 11300722
N-[(E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoyl]benzamide (PubChem CID 11300722) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoyl]benzamide.
| Compound Name | N-[(E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoyl]benzamide |
|---|---|
| PubChem CID | 11300722 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoyl]benzamide |
| SMILES | CC1(C)OC[C@H](C/C=C/C(=O)NC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)20-11-13(21-16)9-6-10-14(18)17-15(19)12-7-4-3-5-8-12/h3-8,10,13H,9,11H2,1-2H3,(H,17,18,19)/b10-6+/t13-/m0/s1 |
| InChIKey | WSWKOPZZFALEIR-PPOCWRSBSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|