C19H25N3O5S — CID 8540226
methyl 2-[4-oxo-2-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanylquinazolin-3-yl]acetate (PubChem CID 8540226) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 2-[4-oxo-2-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanylquinazolin-3-yl]acetate.
| Compound Name | methyl 2-[4-oxo-2-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanylquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 8540226 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 2-[4-oxo-2-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanylquinazolin-3-yl]acetate |
| SMILES | COC(=O)Cn1c(SCC(=O)NCCCOC(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H25N3O5S/c1-13(2)27-10-6-9-20-16(23)12-28-19-21-15-8-5-4-7-14(15)18(25)22(19)11-17(24)26-3/h4-5,7-8,13H,6,9-12H2,1-3H3,(H,20,23) |
| InChIKey | PMPUBECQECGHMV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|