C19H20ClN2O+ — CID 8540485
(4-chlorophenyl)methyl-[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8540485) has the molecular formula C19H20ClN2O+ and a molecular weight of 327.84 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (4-chlorophenyl)methyl-[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8540485 |
| Molecular Formula | C19H20ClN2O+ |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (4-chlorophenyl)methyl-[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylazanium |
| SMILES | C[C@H](C(=O)c1c[nH]c2ccccc12)[NH+](C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O/c1-13(22(2)12-14-7-9-15(20)10-8-14)19(23)17-11-21-18-6-4-3-5-16(17)18/h3-11,13,21H,12H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | SCWUOEHFZAKIFO-CYBMUJFWSA-O |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |