C18H21N2OS+ — CID 8804430
[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium (PubChem CID 8804430) has the molecular formula C18H21N2OS+ and a molecular weight of 313.45 g/mol. Its IUPAC name is [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium.
| Compound Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8804430 |
| Molecular Formula | C18H21N2OS+ |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium |
| SMILES | Cc1ccsc1C[NH+](C)[C@H](C)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20N2OS/c1-12-8-9-22-17(12)11-20(3)13(2)18(21)15-10-19-16-7-5-4-6-14(15)16/h4-10,13,19H,11H2,1-3H3/p+1/t13-/m1/s1 |
| InChIKey | IOMCQRGUIONHFG-CYBMUJFWSA-O |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |