C18H23NO5S — CID 85410122
tert-butyl 5-hydroxy-6-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 85410122) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-6-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-6-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 85410122 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | tert-butyl 5-hydroxy-6-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C2C(O)C3C=CC2N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-11-5-7-12(8-6-11)25(22,23)16-14-10-9-13(15(16)20)19(14)17(21)24-18(2,3)4/h5-10,13-16,20H,1-4H3 |
| InChIKey | HEAIOYWOPVVORW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|