C18H15F3O — CID 85416858
9-methyl-10-(2,2,2-trifluoro-1-methoxyethyl)anthracene (PubChem CID 85416858) has the molecular formula C18H15F3O and a molecular weight of 304.31 g/mol. Its IUPAC name is 9-methyl-10-(2,2,2-trifluoro-1-methoxyethyl)anthracene.
| Compound Name | 9-methyl-10-(2,2,2-trifluoro-1-methoxyethyl)anthracene |
|---|---|
| PubChem CID | 85416858 |
| Molecular Formula | C18H15F3O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 9-methyl-10-(2,2,2-trifluoro-1-methoxyethyl)anthracene |
| SMILES | COC(c1c2ccccc2c(C)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C18H15F3O/c1-11-12-7-3-5-9-14(12)16(17(22-2)18(19,20)21)15-10-6-4-8-13(11)15/h3-10,17H,1-2H3 |
| InChIKey | WHQBIORPCFKJJC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|