C19H16FN3O2S — CID 85417464
N-(2-aminophenyl)-5-[[(2-fluorophenyl)methylideneamino]oxymethyl]thiophene-2-carboxamide (PubChem CID 85417464) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[(2-fluorophenyl)methylideneamino]oxymethyl]thiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[(2-fluorophenyl)methylideneamino]oxymethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 85417464 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-(2-aminophenyl)-5-[[(2-fluorophenyl)methylideneamino]oxymethyl]thiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CON=Cc2ccccc2F)s1 |
| InChI | InChI=1S/C19H16FN3O2S/c20-15-6-2-1-5-13(15)11-22-25-12-14-9-10-18(26-14)19(24)23-17-8-4-3-7-16(17)21/h1-11H,12,21H2,(H,23,24) |
| InChIKey | JDLCZASOCSLLDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|