C21H29N3O2S — CID 10340189
2-N-(2-aminophenyl)-5-N-nonylthiophene-2,5-dicarboxamide (PubChem CID 10340189) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-nonylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-nonylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10340189 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-nonylthiophene-2,5-dicarboxamide |
| SMILES | CCCCCCCCCNC(=O)c1ccc(C(=O)Nc2ccccc2N)s1 |
| InChI | InChI=1S/C21H29N3O2S/c1-2-3-4-5-6-7-10-15-23-20(25)18-13-14-19(27-18)21(26)24-17-12-9-8-11-16(17)22/h8-9,11-14H,2-7,10,15,22H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ZTMJLGBAJJAACY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|