About 5-oxodec-2-enoic acid
5-oxodec-2-enoic acid (PubChem CID 85427475) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-oxodec-2-enoic acid.
Molecular Properties
| Compound Name | 5-oxodec-2-enoic acid |
| PubChem CID | 85427475 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-oxodec-2-enoic acid |
| SMILES | CCCCCC(=O)CC=CC(=O)O |
| InChI | InChI=1S/C10H16O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h5,8H,2-4,6-7H2,1H3,(H,12,13) |
| InChIKey | NFTOLDPTKGNETI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-oxodec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxodec-2-enoic acid?
The IUPAC name of 5-oxodec-2-enoic acid (CID 85427475) is 5-oxodec-2-enoic acid.
What is the SMILES notation for 5-oxodec-2-enoic acid?
The canonical SMILES for 5-oxodec-2-enoic acid is CCCCCC(=O)CC=CC(=O)O.
What is the InChIKey of 5-oxodec-2-enoic acid?
The InChIKey is NFTOLDPTKGNETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h5,8H,2-4,6-7H2,1H3,(H,12,13).
What are the key properties of 5-oxodec-2-enoic acid?
5-oxodec-2-enoic acid has a molecular weight of 184.24 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxodec-2-enoic acid is sourced from PubChem (CID 85427475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).