C19H15ClFN3OS — CID 8543095
N-[(2-chlorophenyl)methyl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 8543095) has the molecular formula C19H15ClFN3OS and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8543095 |
| Molecular Formula | C19H15ClFN3OS |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(-c2ccc(F)cc2)nn1)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H15ClFN3OS/c20-16-4-2-1-3-14(16)11-22-18(25)12-26-19-10-9-17(23-24-19)13-5-7-15(21)8-6-13/h1-10H,11-12H2,(H,22,25) |
| InChIKey | WHLPFNUSBUMZJG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |