C20H30O3 — CID 85436289
5a-methyl-6-(6-methylhept-5-en-2-yl)-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione (PubChem CID 85436289) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5a-methyl-6-(6-methylhept-5-en-2-yl)-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione.
| Compound Name | 5a-methyl-6-(6-methylhept-5-en-2-yl)-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 85436289 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 5a-methyl-6-(6-methylhept-5-en-2-yl)-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione |
| SMILES | CC(C)=CCCC(C)C1CC(=O)C2C3CC(=O)OC3CCC12C |
| InChI | InChI=1S/C20H30O3/c1-12(2)6-5-7-13(3)15-11-16(21)19-14-10-18(22)23-17(14)8-9-20(15,19)4/h6,13-15,17,19H,5,7-11H2,1-4H3 |
| InChIKey | QRUFXMACQLIXOI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|