C9H14ClN4O2+ — CID 85442963
[(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-chloromethylidene]-dimethylazanium (PubChem CID 85442963) has the molecular formula C9H14ClN4O2+ and a molecular weight of 245.69 g/mol. Its IUPAC name is [(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-chloromethylidene]-dimethylazanium.
| Compound Name | [(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-chloromethylidene]-dimethylazanium |
|---|---|
| PubChem CID | 85442963 |
| Molecular Formula | C9H14ClN4O2+ |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-chloromethylidene]-dimethylazanium |
| SMILES | Cn1c(N)c(C(Cl)=[N+](C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H13ClN4O2/c1-12(2)6(10)5-7(11)13(3)9(16)14(4)8(5)15/h11H,1-4H3/p+1 |
| InChIKey | BQYZXKFNPDSVPS-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|