C25H24N4O3 — CID 85469018
3-methyl-6-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469018) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-methyl-6-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469018 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-methyl-6-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | Cn1nnc2cc(-c3ccc(-c4ccccc4CN4CCOCC4)cc3)cc(C(=O)O)c21 |
| InChI | InChI=1S/C25H24N4O3/c1-28-24-22(25(30)31)14-20(15-23(24)26-27-28)17-6-8-18(9-7-17)21-5-3-2-4-19(21)16-29-10-12-32-13-11-29/h2-9,14-15H,10-13,16H2,1H3,(H,30,31) |
| InChIKey | PRQJNIRSBHIIQQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |