C27H34ClF3N6O2S — CID 85470115
3-N-[3-chloro-4-[4-[[1-(3,3-dimethylbutyl)piperidin-3-yl]methylsulfonyl]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 85470115) has the molecular formula C27H34ClF3N6O2S and a molecular weight of 599.12 g/mol. Its IUPAC name is 3-N-[3-chloro-4-[4-[[1-(3,3-dimethylbutyl)piperidin-3-yl]methylsulfonyl]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-4-[4-[[1-(3,3-dimethylbutyl)piperidin-3-yl]methylsulfonyl]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 85470115 |
| Molecular Formula | C27H34ClF3N6O2S |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 3-N-[3-chloro-4-[4-[[1-(3,3-dimethylbutyl)piperidin-3-yl]methylsulfonyl]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)(C)CCN1CCCC(CS(=O)(=O)c2ccc(-c3c(Cl)cc(Nc4n[nH]c(N)n4)cc3C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C27H34ClF3N6O2S/c1-26(2,3)10-12-37-11-4-5-17(15-37)16-40(38,39)20-8-6-18(7-9-20)23-21(27(29,30)31)13-19(14-22(23)28)33-25-34-24(32)35-36-25/h6-9,13-14,17H,4-5,10-12,15-16H2,1-3H3,(H4,32,33,34,35,36) |
| InChIKey | BMIBNWSMYJTACH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |