C23H28ClF2IN6O — CID 134470752
3-N-[3-chloro-5-[difluoro(iodo)methyl]-4-[4-[2-(3,3-dimethylbutylamino)ethoxy]phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 134470752) has the molecular formula C23H28ClF2IN6O and a molecular weight of 604.87 g/mol. Its IUPAC name is 3-N-[3-chloro-5-[difluoro(iodo)methyl]-4-[4-[2-(3,3-dimethylbutylamino)ethoxy]phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-5-[difluoro(iodo)methyl]-4-[4-[2-(3,3-dimethylbutylamino)ethoxy]phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 134470752 |
| Molecular Formula | C23H28ClF2IN6O |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 3-N-[3-chloro-5-[difluoro(iodo)methyl]-4-[4-[2-(3,3-dimethylbutylamino)ethoxy]phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)(C)CCNCCOc1ccc(-c2c(Cl)cc(Nc3n[nH]c(N)n3)cc2C(F)(F)I)cc1 |
| InChI | InChI=1S/C23H28ClF2IN6O/c1-22(2,3)8-9-29-10-11-34-16-6-4-14(5-7-16)19-17(23(25,26)27)12-15(13-18(19)24)30-21-31-20(28)32-33-21/h4-7,12-13,29H,8-11H2,1-3H3,(H4,28,30,31,32,33) |
| InChIKey | CCSXNXXARZICLN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|