C23H23ClF6N6O2 — CID 158754654
3-N-[3-chloro-4-(4-piperidin-3-yloxyphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine;3,3,3-trifluoropropanal (PubChem CID 158754654) has the molecular formula C23H23ClF6N6O2 and a molecular weight of 564.92 g/mol. Its IUPAC name is 3-N-[3-chloro-4-(4-piperidin-3-yloxyphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine;3,3,3-trifluoropropanal.
| Compound Name | 3-N-[3-chloro-4-(4-piperidin-3-yloxyphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine;3,3,3-trifluoropropanal |
|---|---|
| PubChem CID | 158754654 |
| Molecular Formula | C23H23ClF6N6O2 |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 3-N-[3-chloro-4-(4-piperidin-3-yloxyphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine;3,3,3-trifluoropropanal |
| SMILES | Nc1nc(Nc2cc(Cl)c(-c3ccc(OC4CCCNC4)cc3)c(C(F)(F)F)c2)n[nH]1.O=CCC(F)(F)F |
| InChI | InChI=1S/C20H20ClF3N6O.C3H3F3O/c21-16-9-12(27-19-28-18(25)29-30-19)8-15(20(22,23)24)17(16)11-3-5-13(6-4-11)31-14-2-1-7-26-10-14;4-3(5,6)1-2-7/h3-6,8-9,14,26H,1-2,7,10H2,(H4,25,27,28,29,30);2H,1H2 |
| InChIKey | INXKLHPGLOABEQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|