C16H19N5 — CID 85471030
2-[[[(1R,2R)-2-aminocyclohexyl]amino]-anilinomethylidene]propanedinitrile (PubChem CID 85471030) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-aminocyclohexyl]amino]-anilinomethylidene]propanedinitrile.
| Compound Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]-anilinomethylidene]propanedinitrile |
|---|---|
| PubChem CID | 85471030 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]-anilinomethylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(Nc1ccccc1)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C16H19N5/c17-10-12(11-18)16(20-13-6-2-1-3-7-13)21-15-9-5-4-8-14(15)19/h1-3,6-7,14-15,20-21H,4-5,8-9,19H2/t14-,15-/m1/s1 |
| InChIKey | GJNMJNAPNUKVDE-HUUCEWRRSA-N |
| XLogP | 2.22 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|