C29H33N3O2 — CID 85475091
N-[3-(4-benzhydrylpiperazin-1-yl)-1-(4-methylphenyl)-3-oxopropyl]acetamide (PubChem CID 85475091) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[3-(4-benzhydrylpiperazin-1-yl)-1-(4-methylphenyl)-3-oxopropyl]acetamide.
| Compound Name | N-[3-(4-benzhydrylpiperazin-1-yl)-1-(4-methylphenyl)-3-oxopropyl]acetamide |
|---|---|
| PubChem CID | 85475091 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[3-(4-benzhydrylpiperazin-1-yl)-1-(4-methylphenyl)-3-oxopropyl]acetamide |
| SMILES | CC(=O)NC(CC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-22-13-15-24(16-14-22)27(30-23(2)33)21-28(34)31-17-19-32(20-18-31)29(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-16,27,29H,17-21H2,1-2H3,(H,30,33) |
| InChIKey | ZNYAMRAZCCTHAA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |