C23H30N3O2+ — CID 9105902
N-[(1R)-3-[4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-3-oxo-1-phenylpropyl]acetamide (PubChem CID 9105902) has the molecular formula C23H30N3O2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[(1R)-3-[4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-3-oxo-1-phenylpropyl]acetamide.
| Compound Name | N-[(1R)-3-[4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-3-oxo-1-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 9105902 |
| Molecular Formula | C23H30N3O2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[(1R)-3-[4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-3-oxo-1-phenylpropyl]acetamide |
| SMILES | CC(=O)N[C@H](CC(=O)N1CC[NH+](Cc2cccc(C)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c1-18-7-6-8-20(15-18)17-25-11-13-26(14-12-25)23(28)16-22(24-19(2)27)21-9-4-3-5-10-21/h3-10,15,22H,11-14,16-17H2,1-2H3,(H,24,27)/p+1/t22-/m1/s1 |
| InChIKey | UDYWNPGTTHLIIO-JOCHJYFZSA-O |
| XLogP | 1.49 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |