C24H26ClN3O — CID 85479721
7-chloro-1-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]quinolin-2-one (PubChem CID 85479721) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is 7-chloro-1-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]quinolin-2-one.
| Compound Name | 7-chloro-1-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]quinolin-2-one |
|---|---|
| PubChem CID | 85479721 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 7-chloro-1-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]quinolin-2-one |
| SMILES | Cn1c(=O)c(CN2CCN(CC=Cc3ccccc3)CC2)cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H26ClN3O/c1-26-23-17-22(25)10-9-20(23)16-21(24(26)29)18-28-14-12-27(13-15-28)11-5-8-19-6-3-2-4-7-19/h2-10,16-17H,11-15,18H2,1H3 |
| InChIKey | XGXQFUADDZVRJJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |