C19H26N4O4 — CID 8549336
(4S)-1-tert-butyl-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 8549336) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (4S)-1-tert-butyl-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-tert-butyl-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8549336 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (4S)-1-tert-butyl-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)N1C[C@@H](C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)CC1=O |
| InChI | InChI=1S/C19H26N4O4/c1-19(2,3)22-13-14(12-17(22)24)18(25)21-10-8-20(9-11-21)15-4-6-16(7-5-15)23(26)27/h4-7,14H,8-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | OZDABJZIEHBBDC-AWEZNQCLSA-N |
| XLogP | 1.89 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|