C17H21N3O3 — CID 8552943
[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate (PubChem CID 8552943) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 8552943 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate |
| SMILES | CC[C@H](C)NC(=O)COC(=O)c1ccc(-n2nccc2C)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-4-12(2)19-16(21)11-23-17(22)14-5-7-15(8-6-14)20-13(3)9-10-18-20/h5-10,12H,4,11H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | GSHGIXFQFSHRKT-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |