C18H15N3O4S — CID 8552225
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-(5-methylpyrazol-1-yl)benzoate (PubChem CID 8552225) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-(5-methylpyrazol-1-yl)benzoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-(5-methylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 8552225 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-(5-methylpyrazol-1-yl)benzoate |
| SMILES | Cc1ccnn1-c1ccc(C(=O)OCC(=O)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H15N3O4S/c1-12-8-9-19-21(12)14-6-4-13(5-7-14)18(24)25-11-16(22)20-17(23)15-3-2-10-26-15/h2-10H,11H2,1H3,(H,20,22,23) |
| InChIKey | WZIYYNJHECEXIA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |