C21H28N2O2 — CID 8557880
N-[(6-methoxynaphthalen-2-yl)methyl]-N-methyl-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 8557880) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[(6-methoxynaphthalen-2-yl)methyl]-N-methyl-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-[(6-methoxynaphthalen-2-yl)methyl]-N-methyl-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8557880 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[(6-methoxynaphthalen-2-yl)methyl]-N-methyl-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | COc1ccc2cc(CN(C)C(=O)CN3CCC(C)CC3)ccc2c1 |
| InChI | InChI=1S/C21H28N2O2/c1-16-8-10-23(11-9-16)15-21(24)22(2)14-17-4-5-19-13-20(25-3)7-6-18(19)12-17/h4-7,12-13,16H,8-11,14-15H2,1-3H3 |
| InChIKey | LZOIUZHPLIYFPL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |