C13H21N2OS+ — CID 8559628
(2-amino-2-oxoethyl)-[(4-methylsulfanylphenyl)methyl]-propan-2-ylazanium (PubChem CID 8559628) has the molecular formula C13H21N2OS+ and a molecular weight of 253.39 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[(4-methylsulfanylphenyl)methyl]-propan-2-ylazanium.
| Compound Name | (2-amino-2-oxoethyl)-[(4-methylsulfanylphenyl)methyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 8559628 |
| Molecular Formula | C13H21N2OS+ |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | (2-amino-2-oxoethyl)-[(4-methylsulfanylphenyl)methyl]-propan-2-ylazanium |
| SMILES | CSc1ccc(C[NH+](CC(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C13H20N2OS/c1-10(2)15(9-13(14)16)8-11-4-6-12(17-3)7-5-11/h4-7,10H,8-9H2,1-3H3,(H2,14,16)/p+1 |
| InChIKey | YZTPSHXHMPIELK-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |