C16H20N4OS3 — CID 8559689
1-(3-methylsulfanylpropyl)-3-[[2-(4-phenyl-1,3-thiazol-2-yl)acetyl]amino]thiourea (PubChem CID 8559689) has the molecular formula C16H20N4OS3 and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[[2-(4-phenyl-1,3-thiazol-2-yl)acetyl]amino]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[[2-(4-phenyl-1,3-thiazol-2-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8559689 |
| Molecular Formula | C16H20N4OS3 |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[[2-(4-phenyl-1,3-thiazol-2-yl)acetyl]amino]thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H20N4OS3/c1-23-9-5-8-17-16(22)20-19-14(21)10-15-18-13(11-24-15)12-6-3-2-4-7-12/h2-4,6-7,11H,5,8-10H2,1H3,(H,19,21)(H2,17,20,22) |
| InChIKey | QFWYXAVPBTUMLE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|