C17H14F3N3O6 — CID 8562702
(2R)-2-(4-methyl-2-nitrophenoxy)-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 8562702) has the molecular formula C17H14F3N3O6 and a molecular weight of 413.31 g/mol. Its IUPAC name is (2R)-2-(4-methyl-2-nitrophenoxy)-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-(4-methyl-2-nitrophenoxy)-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 8562702 |
| Molecular Formula | C17H14F3N3O6 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (2R)-2-(4-methyl-2-nitrophenoxy)-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc(O[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14F3N3O6/c1-9-3-6-15(14(7-9)23(27)28)29-10(2)16(24)21-13-5-4-11(22(25)26)8-12(13)17(18,19)20/h3-8,10H,1-2H3,(H,21,24)/t10-/m1/s1 |
| InChIKey | DMKYJAOTYCGJCV-SNVBAGLBSA-N |
| XLogP | 4.24 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|