C19H18ClN3O3S — CID 8563878
3-(2-chloro-5-nitrophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea (PubChem CID 8563878) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 3-(2-chloro-5-nitrophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea.
| Compound Name | 3-(2-chloro-5-nitrophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 8563878 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 3-(2-chloro-5-nitrophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea |
| SMILES | CCc1oc2ccccc2c1CN(C)C(=S)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H18ClN3O3S/c1-3-17-14(13-6-4-5-7-18(13)26-17)11-22(2)19(27)21-16-10-12(23(24)25)8-9-15(16)20/h4-10H,3,11H2,1-2H3,(H,21,27) |
| InChIKey | XJIYZGXDELOTRN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|