C19H19BrN2OS — CID 9241500
3-(3-bromophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea (PubChem CID 9241500) has the molecular formula C19H19BrN2OS and a molecular weight of 403.35 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea.
| Compound Name | 3-(3-bromophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 9241500 |
| Molecular Formula | C19H19BrN2OS |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 3-(3-bromophenyl)-1-[(2-ethyl-1-benzofuran-3-yl)methyl]-1-methylthiourea |
| SMILES | CCc1oc2ccccc2c1CN(C)C(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H19BrN2OS/c1-3-17-16(15-9-4-5-10-18(15)23-17)12-22(2)19(24)21-14-8-6-7-13(20)11-14/h4-11H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | IJHMRRXEEACILA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|