C21H16ClN3O2S — CID 8565341
2-(6-chloro-4-oxoquinazolin-3-yl)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 8565341) has the molecular formula C21H16ClN3O2S and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-(6-chloro-4-oxoquinazolin-3-yl)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(6-chloro-4-oxoquinazolin-3-yl)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 8565341 |
| Molecular Formula | C21H16ClN3O2S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-(6-chloro-4-oxoquinazolin-3-yl)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(Cn1cnc2ccc(Cl)cc2c1=O)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H16ClN3O2S/c22-15-8-9-17-16(11-15)21(27)25(13-23-17)12-19(26)24-20(18-7-4-10-28-18)14-5-2-1-3-6-14/h1-11,13,20H,12H2,(H,24,26)/t20-/m0/s1 |
| InChIKey | FLKGJSCYFWKIFR-FQEVSTJZSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |