C25H24FN3O2S — CID 55576408
N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55576408) has the molecular formula C25H24FN3O2S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55576408 |
| Molecular Formula | C25H24FN3O2S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCCCc1ccc(C(NC(=O)Cn2cnc3ccc(F)cc3c2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C25H24FN3O2S/c1-2-3-5-17-7-9-18(10-8-17)24(22-6-4-13-32-22)28-23(30)15-29-16-27-21-12-11-19(26)14-20(21)25(29)31/h4,6-14,16,24H,2-3,5,15H2,1H3,(H,28,30) |
| InChIKey | FYSNCGACEFBJIO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |