C20H24N2O7 — CID 8566529
N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(2-methoxy-5-nitrophenoxy)-N-methylacetamide (PubChem CID 8566529) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(2-methoxy-5-nitrophenoxy)-N-methylacetamide.
| Compound Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(2-methoxy-5-nitrophenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 8566529 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(2-methoxy-5-nitrophenoxy)-N-methylacetamide |
| SMILES | COc1cc(C)c(CN(C)C(=O)COc2cc([N+](=O)[O-])ccc2OC)cc1OC |
| InChI | InChI=1S/C20H24N2O7/c1-13-8-17(27-4)18(28-5)9-14(13)11-21(2)20(23)12-29-19-10-15(22(24)25)6-7-16(19)26-3/h6-10H,11-12H2,1-5H3 |
| InChIKey | XNNXBLZKEOPKHW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|