C23H21NO4S — CID 8567516
[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 8567516) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 8567516 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](OC(=O)/C=C/c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO4S/c1-2-27-20-11-7-6-10-19(20)24-23(26)22(18-8-4-3-5-9-18)28-21(25)13-12-17-14-15-29-16-17/h3-16,22H,2H2,1H3,(H,24,26)/b13-12+/t22-/m0/s1 |
| InChIKey | KRLAIHFLPZUJSZ-GNNUASRNSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|