C23H18N4O — CID 8567794
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 8567794) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 8567794 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | C[C@H](Nc1nc(-c2cccnc2)nc2ccccc12)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H18N4O/c1-15(21-13-16-7-2-5-11-20(16)28-21)25-23-18-9-3-4-10-19(18)26-22(27-23)17-8-6-12-24-14-17/h2-15H,1H3,(H,25,26,27)/t15-/m0/s1 |
| InChIKey | AHAIMRVIQOEGEQ-HNNXBMFYSA-N |
| XLogP | 5.61 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |