C23H19N7 — CID 133365280
N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 133365280) has the molecular formula C23H19N7 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 133365280 |
| Molecular Formula | C23H19N7 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CC(Nc1nc(-c2cccnc2)nc2ccccc12)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C23H19N7/c1-16(21-15-30(29-28-21)18-9-3-2-4-10-18)25-23-19-11-5-6-12-20(19)26-22(27-23)17-8-7-13-24-14-17/h2-16H,1H3,(H,25,26,27) |
| InChIKey | PKUHAAGJLYUCGJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |