C21H28N2O6 — CID 8567917
[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 8567917) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8567917 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1OCCNC(=O)COC(=O)[C@H]1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C21H28N2O6/c1-27-17-8-4-5-9-18(17)28-11-10-22-19(24)14-29-21(26)15-12-20(25)23(13-15)16-6-2-3-7-16/h4-5,8-9,15-16H,2-3,6-7,10-14H2,1H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | KNQLXOIUMYOPKI-HNNXBMFYSA-N |
| XLogP | 1.52 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|