C20H27NO3 — CID 97010220
(2-methyl-2-phenylpropyl) (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 97010220) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2-methyl-2-phenylpropyl) (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-methyl-2-phenylpropyl) (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97010220 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2-methyl-2-phenylpropyl) (3S)-1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC(C)(COC(=O)[C@H]1CC(=O)N(C2CCCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-20(2,16-8-4-3-5-9-16)14-24-19(23)15-12-18(22)21(13-15)17-10-6-7-11-17/h3-5,8-9,15,17H,6-7,10-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | CERSAIFEXFDEEH-HNNXBMFYSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |