C19H18O3S — CID 8568683
[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 8568683) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 8568683 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccsc1)OCC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H18O3S/c20-18(12-22-19(21)8-5-14-9-10-23-13-14)17-7-6-15-3-1-2-4-16(15)11-17/h5-11,13H,1-4,12H2/b8-5+ |
| InChIKey | CPORAVAISZCTIG-VMPITWQZSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|